C14H28N6O — CID 80900261
4-hydrazinyl-N-pentyl-N-propan-2-yl-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 80900261) has the molecular formula C14H28N6O and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-hydrazinyl-N-pentyl-N-propan-2-yl-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-pentyl-N-propan-2-yl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80900261 |
| Molecular Formula | C14H28N6O |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4-hydrazinyl-N-pentyl-N-propan-2-yl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CCCCCN(c1nc(NN)nc(OC(C)C)n1)C(C)C |
| InChI | InChI=1S/C14H28N6O/c1-6-7-8-9-20(10(2)3)13-16-12(19-15)17-14(18-13)21-11(4)5/h10-11H,6-9,15H2,1-5H3,(H,16,17,18,19) |
| InChIKey | ONWALOZNZNKOOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|