C13H27N7O — CID 82943478
4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 82943478) has the molecular formula C13H27N7O and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 82943478 |
| Molecular Formula | C13H27N7O |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 4-N,4-N-diethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(NN)nc(N(CCOC)C(C)C)n1 |
| InChI | InChI=1S/C13H27N7O/c1-6-19(7-2)12-15-11(18-14)16-13(17-12)20(10(3)4)8-9-21-5/h10H,6-9,14H2,1-5H3,(H,15,16,17,18) |
| InChIKey | HBXADNBQNILEQI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|