C23H47N5O4Si — CID 155644145
2-N-ethyl-2-N-octyl-6-propan-2-yloxy-4-N-(triethoxysilylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155644145) has the molecular formula C23H47N5O4Si and a molecular weight of 485.75 g/mol. Its IUPAC name is 2-N-ethyl-2-N-octyl-6-propan-2-yloxy-4-N-(triethoxysilylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethyl-2-N-octyl-6-propan-2-yloxy-4-N-(triethoxysilylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155644145 |
| Molecular Formula | C23H47N5O4Si |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | 2-N-ethyl-2-N-octyl-6-propan-2-yloxy-4-N-(triethoxysilylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCN(CC)c1nc(NC[Si](OCC)(OCC)OCC)nc(OC(C)C)n1 |
| InChI | InChI=1S/C23H47N5O4Si/c1-8-13-14-15-16-17-18-28(9-2)22-25-21(26-23(27-22)32-20(6)7)24-19-33(29-10-3,30-11-4)31-12-5/h20H,8-19H2,1-7H3,(H,24,25,26,27) |
| InChIKey | TZXNFYXOEOJGPI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|