C13H22Cl2N4 — CID 178072208
4,6-dichloro-N,N-dipentyl-1,3,5-triazin-2-amine (PubChem CID 178072208) has the molecular formula C13H22Cl2N4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4,6-dichloro-N,N-dipentyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N,N-dipentyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 178072208 |
| Molecular Formula | C13H22Cl2N4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4,6-dichloro-N,N-dipentyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCN(CCCCC)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C13H22Cl2N4/c1-3-5-7-9-19(10-8-6-4-2)13-17-11(14)16-12(15)18-13/h3-10H2,1-2H3 |
| InChIKey | AMLYURPRQATGCM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|