C11H18Cl2N4 — CID 169438788
4,6-dichloro-N,N-bis(1,1-dideuteriobutyl)-1,3,5-triazin-2-amine (PubChem CID 169438788) has the molecular formula C11H18Cl2N4 and a molecular weight of 281.22 g/mol. Its IUPAC name is 4,6-dichloro-N,N-bis(1,1-dideuteriobutyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N,N-bis(1,1-dideuteriobutyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 169438788 |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4,6-dichloro-N,N-bis(1,1-dideuteriobutyl)-1,3,5-triazin-2-amine |
| SMILES | [2H]C([2H])(CCC)N(c1nc(Cl)nc(Cl)n1)C([2H])([2H])CCC |
| InChI | InChI=1S/C11H18Cl2N4/c1-3-5-7-17(8-6-4-2)11-15-9(12)14-10(13)16-11/h3-8H2,1-2H3/i7D2,8D2 |
| InChIKey | IWGAEEKEEFSIGK-OSEHSPPNSA-N |
| XLogP | 3.59 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |