C23H44ClN5S4 — CID 20504271
6-chloro-2-N,2-N,4-N,4-N-tetrakis(pentylsulfanyl)-1,3,5-triazine-2,4-diamine (PubChem CID 20504271) has the molecular formula C23H44ClN5S4 and a molecular weight of 554.36 g/mol. Its IUPAC name is 6-chloro-2-N,2-N,4-N,4-N-tetrakis(pentylsulfanyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N,4-N,4-N-tetrakis(pentylsulfanyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20504271 |
| Molecular Formula | C23H44ClN5S4 |
| Molecular Weight | 554.36 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 6-chloro-2-N,2-N,4-N,4-N-tetrakis(pentylsulfanyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCSN(SCCCCC)c1nc(Cl)nc(N(SCCCCC)SCCCCC)n1 |
| InChI | InChI=1S/C23H44ClN5S4/c1-5-9-13-17-30-28(31-18-14-10-6-2)22-25-21(24)26-23(27-22)29(32-19-15-11-7-3)33-20-16-12-8-4/h5-20H2,1-4H3 |
| InChIKey | NHCOQHQXVOSWSB-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.36 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|