C27H52ClN5S4 — CID 54106974
6-chloro-2-N,2-N,4-N,4-N-tetrakis(hexylsulfanyl)-1,3,5-triazine-2,4-diamine (PubChem CID 54106974) has the molecular formula C27H52ClN5S4 and a molecular weight of 610.47 g/mol. Its IUPAC name is 6-chloro-2-N,2-N,4-N,4-N-tetrakis(hexylsulfanyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N,4-N,4-N-tetrakis(hexylsulfanyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54106974 |
| Molecular Formula | C27H52ClN5S4 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 6-chloro-2-N,2-N,4-N,4-N-tetrakis(hexylsulfanyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCSN(SCCCCCC)c1nc(Cl)nc(N(SCCCCCC)SCCCCCC)n1 |
| InChI | InChI=1S/C27H52ClN5S4/c1-5-9-13-17-21-34-32(35-22-18-14-10-6-2)26-29-25(28)30-27(31-26)33(36-23-19-15-11-7-3)37-24-20-16-12-8-4/h5-24H2,1-4H3 |
| InChIKey | NEKMUWLZFYBMFT-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|