C16H30ClN5 — CID 604297
6-chloro-2-N,2-N-dihexyl-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 604297) has the molecular formula C16H30ClN5 and a molecular weight of 327.90 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-dihexyl-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-dihexyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 604297 |
| Molecular Formula | C16H30ClN5 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 6-chloro-2-N,2-N-dihexyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCN(CCCCCC)c1nc(Cl)nc(NC)n1 |
| InChI | InChI=1S/C16H30ClN5/c1-4-6-8-10-12-22(13-11-9-7-5-2)16-20-14(17)19-15(18-3)21-16/h4-13H2,1-3H3,(H,18,19,20,21) |
| InChIKey | NILTZZQWSJOURD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|