C38H77N7 — CID 59356287
6-N-methyl-6-N-(methylaminomethyl)-2-N,2-N,4-N,4-N-tetraoctyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 59356287) has the molecular formula C38H77N7 and a molecular weight of 632.08 g/mol. Its IUPAC name is 6-N-methyl-6-N-(methylaminomethyl)-2-N,2-N,4-N,4-N-tetraoctyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-methyl-6-N-(methylaminomethyl)-2-N,2-N,4-N,4-N-tetraoctyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59356287 |
| Molecular Formula | C38H77N7 |
| Molecular Weight | 632.08 g/mol |
| Exact Mass | 631.62 |
| IUPAC Name | 6-N-methyl-6-N-(methylaminomethyl)-2-N,2-N,4-N,4-N-tetraoctyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCN(CCCCCCCC)c1nc(N(C)CNC)nc(N(CCCCCCCC)CCCCCCCC)n1 |
| InChI | InChI=1S/C38H77N7/c1-7-11-15-19-23-27-31-44(32-28-24-20-16-12-8-2)37-40-36(43(6)35-39-5)41-38(42-37)45(33-29-25-21-17-13-9-3)34-30-26-22-18-14-10-4/h39H,7-35H2,1-6H3 |
| InChIKey | RPHFFBWXGAGCPV-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.08 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|