C19H37N5 — CID 159008981
6-ethyl-2-N,4-N-dihexyl-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 159008981) has the molecular formula C19H37N5 and a molecular weight of 335.54 g/mol. Its IUPAC name is 6-ethyl-2-N,4-N-dihexyl-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethyl-2-N,4-N-dihexyl-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 159008981 |
| Molecular Formula | C19H37N5 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.30 |
| IUPAC Name | 6-ethyl-2-N,4-N-dihexyl-2-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCN(C)c1nc(CC)nc(N(C)CCCCCC)n1 |
| InChI | InChI=1S/C19H37N5/c1-6-9-11-13-15-23(4)18-20-17(8-3)21-19(22-18)24(5)16-14-12-10-7-2/h6-16H2,1-5H3 |
| InChIKey | GJIZTIIQNUBMHT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|