C13H24N4 — CID 80933276
2-ethyl-4-N,6-N-dimethyl-4-N-pentylpyrimidine-4,6-diamine (PubChem CID 80933276) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-ethyl-4-N,6-N-dimethyl-4-N-pentylpyrimidine-4,6-diamine.
| Compound Name | 2-ethyl-4-N,6-N-dimethyl-4-N-pentylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80933276 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-ethyl-4-N,6-N-dimethyl-4-N-pentylpyrimidine-4,6-diamine |
| SMILES | CCCCCN(C)c1cc(NC)nc(CC)n1 |
| InChI | InChI=1S/C13H24N4/c1-5-7-8-9-17(4)13-10-12(14-3)15-11(6-2)16-13/h10H,5-9H2,1-4H3,(H,14,15,16) |
| InChIKey | LHSJVMTVXKQVLW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|