C19H38N6 — CID 59132939
2-N-[6-(dimethylamino)hexyl]-4-N-hexyl-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 59132939) has the molecular formula C19H38N6 and a molecular weight of 350.56 g/mol. Its IUPAC name is 2-N-[6-(dimethylamino)hexyl]-4-N-hexyl-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[6-(dimethylamino)hexyl]-4-N-hexyl-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59132939 |
| Molecular Formula | C19H38N6 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.32 |
| IUPAC Name | 2-N-[6-(dimethylamino)hexyl]-4-N-hexyl-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCNc1nc(C)nc(N(C)CCCCCCN(C)C)n1 |
| InChI | InChI=1S/C19H38N6/c1-6-7-8-11-14-20-18-21-17(2)22-19(23-18)25(5)16-13-10-9-12-15-24(3)4/h6-16H2,1-5H3,(H,20,21,22,23) |
| InChIKey | MPYOVDPPYCURCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|