C11H21N5O2 — CID 62862123
N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 62862123) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62862123 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | COc1nc(NCCCCN(C)C)nc(OC)n1 |
| InChI | InChI=1S/C11H21N5O2/c1-16(2)8-6-5-7-12-9-13-10(17-3)15-11(14-9)18-4/h5-8H2,1-4H3,(H,12,13,14,15) |
| InChIKey | LJYOEULUFLHXCF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|