C11H21N5O — CID 80786527
4-N-ethyl-6-methoxy-2-N-pentyl-1,3,5-triazine-2,4-diamine (PubChem CID 80786527) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-N-ethyl-6-methoxy-2-N-pentyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-methoxy-2-N-pentyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80786527 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 4-N-ethyl-6-methoxy-2-N-pentyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCNc1nc(NCC)nc(OC)n1 |
| InChI | InChI=1S/C11H21N5O/c1-4-6-7-8-13-10-14-9(12-5-2)15-11(16-10)17-3/h4-8H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | LPZYWHNYXVVETM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|