C20H32N6O — CID 20760965
2-N,6-N-dibutyl-4-N-(4-ethoxyphenyl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20760965) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-N,6-N-dibutyl-4-N-(4-ethoxyphenyl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,6-N-dibutyl-4-N-(4-ethoxyphenyl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20760965 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-N,6-N-dibutyl-4-N-(4-ethoxyphenyl)-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(Nc2ccc(OCC)cc2)nc(N(C)CCCC)n1 |
| InChI | InChI=1S/C20H32N6O/c1-5-8-14-21-18-23-19(25-20(24-18)26(4)15-9-6-2)22-16-10-12-17(13-11-16)27-7-3/h10-13H,5-9,14-15H2,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | IPGIDKQEYQGROE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|