C17H26N6 — CID 101120334
4-N-butyl-2-N-(4-tert-butylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 101120334) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4-N-butyl-2-N-(4-tert-butylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 101120334 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(N)nc(Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C17H26N6/c1-5-6-11-19-15-21-14(18)22-16(23-15)20-13-9-7-12(8-10-13)17(2,3)4/h7-10H,5-6,11H2,1-4H3,(H4,18,19,20,21,22,23) |
| InChIKey | VJFWJOFIRDGQJG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|