C19H33N9 — CID 58722838
2-N-(4-aminophenyl)-4-N,6-N-bis[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 58722838) has the molecular formula C19H33N9 and a molecular weight of 387.54 g/mol. Its IUPAC name is 2-N-(4-aminophenyl)-4-N,6-N-bis[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-aminophenyl)-4-N,6-N-bis[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 58722838 |
| Molecular Formula | C19H33N9 |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 2-N-(4-aminophenyl)-4-N,6-N-bis[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCNc1nc(NCCCN(C)C)nc(Nc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C19H33N9/c1-27(2)13-5-11-21-17-24-18(22-12-6-14-28(3)4)26-19(25-17)23-16-9-7-15(20)8-10-16/h7-10H,5-6,11-14,20H2,1-4H3,(H3,21,22,23,24,25,26) |
| InChIKey | VTNDPEATEZIJDV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|