C15H17Cl5N6 — CID 134261293
2-N-(3,4-dichlorophenyl)-4-N-[3-(dimethylamino)propyl]-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 134261293) has the molecular formula C15H17Cl5N6 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-4-N-[3-(dimethylamino)propyl]-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3,4-dichlorophenyl)-4-N-[3-(dimethylamino)propyl]-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134261293 |
| Molecular Formula | C15H17Cl5N6 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-4-N-[3-(dimethylamino)propyl]-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(Nc2ccc(Cl)c(Cl)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C15H17Cl5N6/c1-26(2)7-3-6-21-13-23-12(15(18,19)20)24-14(25-13)22-9-4-5-10(16)11(17)8-9/h4-5,8H,3,6-7H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | JMOHXDZTNHIDFH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|