C16H17Cl6N5 — CID 134261357
N',N'-dimethyl-N-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine (PubChem CID 134261357) has the molecular formula C16H17Cl6N5 and a molecular weight of 492.07 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 134261357 |
| Molecular Formula | C16H17Cl6N5 |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | N',N'-dimethyl-N-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2ccc(C(Cl)(Cl)Cl)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C16H17Cl6N5/c1-27(2)9-3-8-23-14-25-12(24-13(26-14)16(20,21)22)10-4-6-11(7-5-10)15(17,18)19/h4-7H,3,8-9H2,1-2H3,(H,23,24,25,26) |
| InChIKey | KEECDXTUIZVIHM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|