C25H36Cl3N5 — CID 121312133
N-[3-(azepan-1-yl)-2,2-dimethylpropyl]-4-(4-tert-butylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 121312133) has the molecular formula C25H36Cl3N5 and a molecular weight of 512.96 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)-2,2-dimethylpropyl]-4-(4-tert-butylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[3-(azepan-1-yl)-2,2-dimethylpropyl]-4-(4-tert-butylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 121312133 |
| Molecular Formula | C25H36Cl3N5 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-[3-(azepan-1-yl)-2,2-dimethylpropyl]-4-(4-tert-butylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)(CNc1nc(-c2ccc(C(C)(C)C)cc2)nc(C(Cl)(Cl)Cl)n1)CN1CCCCCC1 |
| InChI | InChI=1S/C25H36Cl3N5/c1-23(2,3)19-12-10-18(11-13-19)20-30-21(25(26,27)28)32-22(31-20)29-16-24(4,5)17-33-14-8-6-7-9-15-33/h10-13H,6-9,14-17H2,1-5H3,(H,29,30,31,32) |
| InChIKey | YLEIUZSDQXZRFS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|