C17H17Cl3F3N5 — CID 118250345
N-(2-pyrrolidin-1-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 118250345) has the molecular formula C17H17Cl3F3N5 and a molecular weight of 454.71 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250345 |
| Molecular Formula | C17H17Cl3F3N5 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-4-(trichloromethyl)-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cccc(-c2nc(NCCN3CCCC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C17H17Cl3F3N5/c18-16(19,20)14-25-13(11-4-3-5-12(10-11)17(21,22)23)26-15(27-14)24-6-9-28-7-1-2-8-28/h3-5,10H,1-2,6-9H2,(H,24,25,26,27) |
| InChIKey | SBHQWTYCQIAQLW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|