C17H19Cl4N5 — CID 85472415
4-(3-chlorophenyl)-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472415) has the molecular formula C17H19Cl4N5 and a molecular weight of 435.19 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-chlorophenyl)-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472415 |
| Molecular Formula | C17H19Cl4N5 |
| Molecular Weight | 435.19 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1cccc(-c2nc(NCCCN3CCCC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C17H19Cl4N5/c18-13-6-3-5-12(11-13)14-23-15(17(19,20)21)25-16(24-14)22-7-4-10-26-8-1-2-9-26/h3,5-6,11H,1-2,4,7-10H2,(H,22,23,24,25) |
| InChIKey | JXCPXIZMLIQDLB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|