C16H18Cl3N5 — CID 85472537
4-phenyl-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472537) has the molecular formula C16H18Cl3N5 and a molecular weight of 386.71 g/mol. Its IUPAC name is 4-phenyl-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-phenyl-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472537 |
| Molecular Formula | C16H18Cl3N5 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-phenyl-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | ClC(Cl)(Cl)c1nc(NCCN2CCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H18Cl3N5/c17-16(18,19)14-21-13(12-6-2-1-3-7-12)22-15(23-14)20-8-11-24-9-4-5-10-24/h1-3,6-7H,4-5,8-11H2,(H,20,21,22,23) |
| InChIKey | HUVJROLNEAQJFX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|