C17H21Cl3N6O — CID 118250329
2-N-(2-methoxyphenyl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 118250329) has the molecular formula C17H21Cl3N6O and a molecular weight of 431.76 g/mol. Its IUPAC name is 2-N-(2-methoxyphenyl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyphenyl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118250329 |
| Molecular Formula | C17H21Cl3N6O |
| Molecular Weight | 431.76 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-N-(2-methoxyphenyl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccccc1Nc1nc(NCCN2CCCC2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H21Cl3N6O/c1-27-13-7-3-2-6-12(13)22-16-24-14(17(18,19)20)23-15(25-16)21-8-11-26-9-4-5-10-26/h2-3,6-7H,4-5,8-11H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | WJXPLJHDSBBQBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|