C19H24Cl3N5O — CID 134261301
4-[(2-methoxyphenyl)methyl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 134261301) has the molecular formula C19H24Cl3N5O and a molecular weight of 444.79 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(2-methoxyphenyl)methyl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134261301 |
| Molecular Formula | C19H24Cl3N5O |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl]-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccccc1Cc1nc(NCCC2CCCN2C)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C19H24Cl3N5O/c1-27-11-5-7-14(27)9-10-23-18-25-16(24-17(26-18)19(20,21)22)12-13-6-3-4-8-15(13)28-2/h3-4,6,8,14H,5,7,9-12H2,1-2H3,(H,23,24,25,26) |
| InChIKey | VFXDDEUWIJYZAY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|