C18H22Cl3N5O — CID 118250600
4-[(2-methoxyphenyl)methyl]-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250600) has the molecular formula C18H22Cl3N5O and a molecular weight of 430.77 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methyl]-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(2-methoxyphenyl)methyl]-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250600 |
| Molecular Formula | C18H22Cl3N5O |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-[(2-methoxyphenyl)methyl]-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccccc1Cc1nc(NC2CCN(C)CC2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C18H22Cl3N5O/c1-26-9-7-13(8-10-26)22-17-24-15(23-16(25-17)18(19,20)21)11-12-5-3-4-6-14(12)27-2/h3-6,13H,7-11H2,1-2H3,(H,22,23,24,25) |
| InChIKey | ZDUWEVNJAKGKCM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|