C17H18Cl3F3N6O — CID 134261340
2-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 134261340) has the molecular formula C17H18Cl3F3N6O and a molecular weight of 485.73 g/mol. Its IUPAC name is 2-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134261340 |
| Molecular Formula | C17H18Cl3F3N6O |
| Molecular Weight | 485.73 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN1CCC(Nc2nc(Nc3ccc(OC(F)(F)F)cc3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C17H18Cl3F3N6O/c1-29-8-6-11(7-9-29)25-15-27-13(16(18,19)20)26-14(28-15)24-10-2-4-12(5-3-10)30-17(21,22)23/h2-5,11H,6-9H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | BZJLWVGMZDXRLM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|