C16H16Cl3F3N6O — CID 118250351
4-(1,4-diazepan-1-yl)-6-(trichloromethyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 118250351) has the molecular formula C16H16Cl3F3N6O and a molecular weight of 471.70 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-6-(trichloromethyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,4-diazepan-1-yl)-6-(trichloromethyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250351 |
| Molecular Formula | C16H16Cl3F3N6O |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-6-(trichloromethyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2nc(N3CCCNCC3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C16H16Cl3F3N6O/c17-15(18,19)12-25-13(27-14(26-12)28-8-1-6-23-7-9-28)24-10-2-4-11(5-3-10)29-16(20,21)22/h2-5,23H,1,6-9H2,(H,24,25,26,27) |
| InChIKey | LKOIUYMGGWXFDB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|