C16H17Cl4N5 — CID 118250695
4-(3-chlorophenyl)-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250695) has the molecular formula C16H17Cl4N5 and a molecular weight of 421.16 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-chlorophenyl)-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250695 |
| Molecular Formula | C16H17Cl4N5 |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(1-methylpiperidin-4-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCC(Nc2nc(-c3cccc(Cl)c3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C16H17Cl4N5/c1-25-7-5-12(6-8-25)21-15-23-13(10-3-2-4-11(17)9-10)22-14(24-15)16(18,19)20/h2-4,9,12H,5-8H2,1H3,(H,21,22,23,24) |
| InChIKey | QLPRUQMTWZLYQB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|