C21H27Cl3N6 — CID 85472413
N-(1-ethylpiperidin-3-yl)-4-(4-pyrrolidin-1-ylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472413) has the molecular formula C21H27Cl3N6 and a molecular weight of 469.85 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-4-(4-pyrrolidin-1-ylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-(1-ethylpiperidin-3-yl)-4-(4-pyrrolidin-1-ylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472413 |
| Molecular Formula | C21H27Cl3N6 |
| Molecular Weight | 469.85 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-4-(4-pyrrolidin-1-ylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN1CCCC(Nc2nc(-c3ccc(N4CCCC4)cc3)nc(C(Cl)(Cl)Cl)n2)C1 |
| InChI | InChI=1S/C21H27Cl3N6/c1-2-29-11-5-6-16(14-29)25-20-27-18(26-19(28-20)21(22,23)24)15-7-9-17(10-8-15)30-12-3-4-13-30/h7-10,16H,2-6,11-14H2,1H3,(H,25,26,27,28) |
| InChIKey | ZXMYBQZQJJQYTH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|