C20H24Cl3N5O2 — CID 118250255
ethyl 4-[4-[(1-ethylpyrrolidin-3-yl)methylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]benzoate (PubChem CID 118250255) has the molecular formula C20H24Cl3N5O2 and a molecular weight of 472.80 g/mol. Its IUPAC name is ethyl 4-[4-[(1-ethylpyrrolidin-3-yl)methylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]benzoate.
| Compound Name | ethyl 4-[4-[(1-ethylpyrrolidin-3-yl)methylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
|---|---|
| PubChem CID | 118250255 |
| Molecular Formula | C20H24Cl3N5O2 |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | ethyl 4-[4-[(1-ethylpyrrolidin-3-yl)methylamino]-6-(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2nc(NCC3CCN(CC)C3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C20H24Cl3N5O2/c1-3-28-10-9-13(12-28)11-24-19-26-16(25-18(27-19)20(21,22)23)14-5-7-15(8-6-14)17(29)30-4-2/h5-8,13H,3-4,9-12H2,1-2H3,(H,24,25,26,27) |
| InChIKey | LXKNUFPPOWFJFU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|