C17H19Cl4N5 — CID 118250537
4-(3-chlorophenyl)-N-(1-ethylpiperidin-3-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250537) has the molecular formula C17H19Cl4N5 and a molecular weight of 435.19 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(1-ethylpiperidin-3-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-chlorophenyl)-N-(1-ethylpiperidin-3-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250537 |
| Molecular Formula | C17H19Cl4N5 |
| Molecular Weight | 435.19 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(1-ethylpiperidin-3-yl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN1CCCC(Nc2nc(-c3cccc(Cl)c3)nc(C(Cl)(Cl)Cl)n2)C1 |
| InChI | InChI=1S/C17H19Cl4N5/c1-2-26-8-4-7-13(10-26)22-16-24-14(11-5-3-6-12(18)9-11)23-15(25-16)17(19,20)21/h3,5-6,9,13H,2,4,7-8,10H2,1H3,(H,22,23,24,25) |
| InChIKey | KEZGTUGIUHFKDC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|