C19H15ClN4O2 — CID 74221229
4-[[4-(3-chlorophenyl)-6-cyclopropyl-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 74221229) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-6-cyclopropyl-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-(3-chlorophenyl)-6-cyclopropyl-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 74221229 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-6-cyclopropyl-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3cccc(Cl)c3)nc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C19H15ClN4O2/c20-14-3-1-2-13(10-14)17-22-16(11-4-5-11)23-19(24-17)21-15-8-6-12(7-9-15)18(25)26/h1-3,6-11H,4-5H2,(H,25,26)(H,21,22,23,24) |
| InChIKey | HQJJTHYXAGWJCX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |