C12H17Cl3N4 — CID 558432
N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-(trichloromethyl)pyrimidin-2-amine (PubChem CID 558432) has the molecular formula C12H17Cl3N4 and a molecular weight of 323.66 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-(trichloromethyl)pyrimidin-2-amine.
| Compound Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-(trichloromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 558432 |
| Molecular Formula | C12H17Cl3N4 |
| Molecular Weight | 323.66 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-(trichloromethyl)pyrimidin-2-amine |
| SMILES | CN1CCCC1CCNc1nccc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H17Cl3N4/c1-19-8-2-3-9(19)4-6-16-11-17-7-5-10(18-11)12(13,14)15/h5,7,9H,2-4,6,8H2,1H3,(H,16,17,18) |
| InChIKey | ZENIQKOCENERDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|