C17H20Cl3N5 — CID 85472538
N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-phenyl-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472538) has the molecular formula C17H20Cl3N5 and a molecular weight of 400.74 g/mol. Its IUPAC name is N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-phenyl-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-phenyl-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472538 |
| Molecular Formula | C17H20Cl3N5 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-phenyl-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CN1CCCC1CCNc1nc(-c2ccccc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H20Cl3N5/c1-25-11-5-8-13(25)9-10-21-16-23-14(12-6-3-2-4-7-12)22-15(24-16)17(18,19)20/h2-4,6-7,13H,5,8-11H2,1H3,(H,21,22,23,24) |
| InChIKey | ZGJJHCICGMQOJC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|