C22H22Cl3N5 — CID 118250229
4-(4-phenylphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250229) has the molecular formula C22H22Cl3N5 and a molecular weight of 462.81 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-phenylphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250229 |
| Molecular Formula | C22H22Cl3N5 |
| Molecular Weight | 462.81 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-(4-phenylphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | ClC(Cl)(Cl)c1nc(NCCN2CCCC2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H22Cl3N5/c23-22(24,25)20-27-19(28-21(29-20)26-12-15-30-13-4-5-14-30)18-10-8-17(9-11-18)16-6-2-1-3-7-16/h1-3,6-11H,4-5,12-15H2,(H,26,27,28,29) |
| InChIKey | QYMFGLGKHAEXHH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|