C21H24Cl3N5O — CID 121312201
4-(2,2-dimethylchromen-6-yl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 121312201) has the molecular formula C21H24Cl3N5O and a molecular weight of 468.82 g/mol. Its IUPAC name is 4-(2,2-dimethylchromen-6-yl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2-dimethylchromen-6-yl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 121312201 |
| Molecular Formula | C21H24Cl3N5O |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 4-(2,2-dimethylchromen-6-yl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CC1(C)C=Cc2cc(-c3nc(NCCN4CCCC4)nc(C(Cl)(Cl)Cl)n3)ccc2O1 |
| InChI | InChI=1S/C21H24Cl3N5O/c1-20(2)8-7-14-13-15(5-6-16(14)30-20)17-26-18(21(22,23)24)28-19(27-17)25-9-12-29-10-3-4-11-29/h5-8,13H,3-4,9-12H2,1-2H3,(H,25,26,27,28) |
| InChIKey | KDDAAIPFHSERAK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|