C19H18Cl3F6N5 — CID 134261352
4-[3,5-bis(trifluoromethyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 134261352) has the molecular formula C19H18Cl3F6N5 and a molecular weight of 536.74 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134261352 |
| Molecular Formula | C19H18Cl3F6N5 |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cc(-c2nc(NCCCN3CCCC3)nc(C(Cl)(Cl)Cl)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18Cl3F6N5/c20-17(21,22)15-30-14(31-16(32-15)29-4-3-7-33-5-1-2-6-33)11-8-12(18(23,24)25)10-13(9-11)19(26,27)28/h8-10H,1-7H2,(H,29,30,31,32) |
| InChIKey | HRWHTHCHJGFHPQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|