C13H19F3N4 — CID 102718410
6-N-(3-pyrrolidin-1-ylpropyl)-4-(trifluoromethyl)pyridine-2,6-diamine (PubChem CID 102718410) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is 6-N-(3-pyrrolidin-1-ylpropyl)-4-(trifluoromethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(3-pyrrolidin-1-ylpropyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102718410 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-N-(3-pyrrolidin-1-ylpropyl)-4-(trifluoromethyl)pyridine-2,6-diamine |
| SMILES | Nc1cc(C(F)(F)F)cc(NCCCN2CCCC2)n1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)10-8-11(17)19-12(9-10)18-4-3-7-20-5-1-2-6-20/h8-9H,1-7H2,(H3,17,18,19) |
| InChIKey | RVXCCEFLFXWDRJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|