C12H21N5 — CID 80914696
6-hydrazinyl-N-(3-pyrrolidin-1-ylpropyl)pyridin-2-amine (PubChem CID 80914696) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-hydrazinyl-N-(3-pyrrolidin-1-ylpropyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-(3-pyrrolidin-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 80914696 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 6-hydrazinyl-N-(3-pyrrolidin-1-ylpropyl)pyridin-2-amine |
| SMILES | NNc1cccc(NCCCN2CCCC2)n1 |
| InChI | InChI=1S/C12H21N5/c13-16-12-6-3-5-11(15-12)14-7-4-10-17-8-1-2-9-17/h3,5-6H,1-2,4,7-10,13H2,(H2,14,15,16) |
| InChIKey | SXMKCNNUJKKPGZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|