C12H18BrN3O — CID 63961941
6-bromo-N-(3-morpholin-4-ylpropyl)pyridin-2-amine (PubChem CID 63961941) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is 6-bromo-N-(3-morpholin-4-ylpropyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-(3-morpholin-4-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63961941 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 6-bromo-N-(3-morpholin-4-ylpropyl)pyridin-2-amine |
| SMILES | Brc1cccc(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C12H18BrN3O/c13-11-3-1-4-12(15-11)14-5-2-6-16-7-9-17-10-8-16/h1,3-4H,2,5-10H2,(H,14,15) |
| InChIKey | UWHZLGZVAFCVBO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|