C23H24Cl2N4O — CID 71199797
5,6-bis(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine (PubChem CID 71199797) has the molecular formula C23H24Cl2N4O and a molecular weight of 443.38 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine.
| Compound Name | 5,6-bis(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 71199797 |
| Molecular Formula | C23H24Cl2N4O |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine |
| SMILES | Clc1ccc(-c2ncc(NCCCN3CCOCC3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H24Cl2N4O/c24-19-6-2-17(3-7-19)22-23(18-4-8-20(25)9-5-18)28-21(16-27-22)26-10-1-11-29-12-14-30-15-13-29/h2-9,16H,1,10-15H2,(H,26,28) |
| InChIKey | TZVLTLCABWWLPB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|