C17H21ClN6O3 — CID 21080855
2-N-(4-chlorophenyl)-4-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 21080855) has the molecular formula C17H21ClN6O3 and a molecular weight of 392.85 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-4-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21080855 |
| Molecular Formula | C17H21ClN6O3 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccc(Cl)cc2)nc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H21ClN6O3/c18-13-2-4-14(5-3-13)21-17-20-12-15(24(25)26)16(22-17)19-6-1-7-23-8-10-27-11-9-23/h2-5,12H,1,6-11H2,(H2,19,20,21,22) |
| InChIKey | LGTKRWGNJWYOOL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|