C14H14ClN5O4 — CID 68581957
2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2-methylpropanoic acid (PubChem CID 68581957) has the molecular formula C14H14ClN5O4 and a molecular weight of 351.75 g/mol. Its IUPAC name is 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68581957 |
| Molecular Formula | C14H14ClN5O4 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C14H14ClN5O4/c1-14(2,12(21)22)19-11-10(20(23)24)7-16-13(18-11)17-9-5-3-8(15)4-6-9/h3-7H,1-2H3,(H,21,22)(H2,16,17,18,19) |
| InChIKey | BHJJTNZJFNCNIX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|