C18H25N5O2 — CID 52949369
4-N-butyl-2-N-(4-tert-butylphenyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 52949369) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-N-butyl-2-N-(4-tert-butylphenyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52949369 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 4-N-butyl-2-N-(4-tert-butylphenyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(Nc2ccc(C(C)(C)C)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N5O2/c1-5-6-11-19-16-15(23(24)25)12-20-17(22-16)21-14-9-7-13(8-10-14)18(2,3)4/h7-10,12H,5-6,11H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | NRFLAIDNEZPFLW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|