C14H21F3N4 — CID 28818192
3-N-(4-pyrrolidin-1-ylbutyl)-5-(trifluoromethyl)pyridine-2,3-diamine (PubChem CID 28818192) has the molecular formula C14H21F3N4 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-N-(4-pyrrolidin-1-ylbutyl)-5-(trifluoromethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(4-pyrrolidin-1-ylbutyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 28818192 |
| Molecular Formula | C14H21F3N4 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-N-(4-pyrrolidin-1-ylbutyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
| SMILES | Nc1ncc(C(F)(F)F)cc1NCCCCN1CCCC1 |
| InChI | InChI=1S/C14H21F3N4/c15-14(16,17)11-9-12(13(18)20-10-11)19-5-1-2-6-21-7-3-4-8-21/h9-10,19H,1-8H2,(H2,18,20) |
| InChIKey | UNTARBZMDHVRLQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|