C10H14F3N3 — CID 28818128
3-N-tert-butyl-5-(trifluoromethyl)pyridine-2,3-diamine (PubChem CID 28818128) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-N-tert-butyl-5-(trifluoromethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-tert-butyl-5-(trifluoromethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 28818128 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-N-tert-butyl-5-(trifluoromethyl)pyridine-2,3-diamine |
| SMILES | CC(C)(C)Nc1cc(C(F)(F)F)cnc1N |
| InChI | InChI=1S/C10H14F3N3/c1-9(2,3)16-7-4-6(10(11,12)13)5-15-8(7)14/h4-5,16H,1-3H3,(H2,14,15) |
| InChIKey | YFQOSIJBXHLXIL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |