C16H26F3N3 — CID 98622752
3-N-decyl-5-(trifluoromethyl)pyridine-2,3-diamine (PubChem CID 98622752) has the molecular formula C16H26F3N3 and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-N-decyl-5-(trifluoromethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-decyl-5-(trifluoromethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 98622752 |
| Molecular Formula | C16H26F3N3 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-N-decyl-5-(trifluoromethyl)pyridine-2,3-diamine |
| SMILES | CCCCCCCCCCNc1cc(C(F)(F)F)cnc1N |
| InChI | InChI=1S/C16H26F3N3/c1-2-3-4-5-6-7-8-9-10-21-14-11-13(16(17,18)19)12-22-15(14)20/h11-12,21H,2-10H2,1H3,(H2,20,22) |
| InChIKey | DBJRYNWWKUQHJW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|