C15H24F3N5 — CID 170171938
N-ethyl-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-amine (PubChem CID 170171938) has the molecular formula C15H24F3N5 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-ethyl-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-amine.
| Compound Name | N-ethyl-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 170171938 |
| Molecular Formula | C15H24F3N5 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-ethyl-4-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]butan-1-amine |
| SMILES | CCNCCCCN1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H24F3N5/c1-2-19-5-3-4-6-22-7-9-23(10-8-22)14-20-11-13(12-21-14)15(16,17)18/h11-12,19H,2-10H2,1H3 |
| InChIKey | BSEAACBSJXBTOU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|