C18H21Cl6N5 — CID 118250230
N',N'-diethyl-N-[4-(trichloromethyl)-6-[3-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine (PubChem CID 118250230) has the molecular formula C18H21Cl6N5 and a molecular weight of 520.12 g/mol. Its IUPAC name is N',N'-diethyl-N-[4-(trichloromethyl)-6-[3-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[4-(trichloromethyl)-6-[3-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 118250230 |
| Molecular Formula | C18H21Cl6N5 |
| Molecular Weight | 520.12 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | N',N'-diethyl-N-[4-(trichloromethyl)-6-[3-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(-c2cccc(C(Cl)(Cl)Cl)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C18H21Cl6N5/c1-3-29(4-2)10-6-9-25-16-27-14(26-15(28-16)18(22,23)24)12-7-5-8-13(11-12)17(19,20)21/h5,7-8,11H,3-4,6,9-10H2,1-2H3,(H,25,26,27,28) |
| InChIKey | HSTJKZDGVJGQIE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.12 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|